CAS 467-98-1 appears in our catalog under these names: Thebainone (1mg/ml in Acetonitrile), Thebainone. Offered by: TRC. Available pack sizes: 5x1ml, 50mg, 5mg.
(1S,9R,10R)-3-hydroxy-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (CAS 467-98-1) is a chemical compound with the molecular formula C18H21NO3 and a molecular weight of 299.4 g/mol. IUPAC name: (1S,9R,10R)-3-hydroxy-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one. InChIKey: SLJDAVMWFVYEFI-IYOUNJFTSA-N.
| Molecular formula | C18H21NO3 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (1S,9R,10R)-3-hydroxy-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| InChIKey | SLJDAVMWFVYEFI-IYOUNJFTSA-N |
| SMILES | CN1CC[C@]23CC(=O)C=C[C@H]2[C@H]1CC4=C3C(=C(C=C4)OC)O |
Computed by PubChem (NCBI)