CAS 4676-39-5 is the registry number for Piperonyl Methyl Ketone. Offered by: ZABRONIONE. Available pack sizes: All package sizes.
1-(1,3-benzodioxol-5-yl)propan-2-one (CAS 4676-39-5) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)propan-2-one. InChIKey: XIYKRJLTYKUWAM-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)propan-2-one |
| InChIKey | XIYKRJLTYKUWAM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)