CAS 468-53-1 appears in our catalog under these names: Mesembrine, (+)-Mesembrine. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 2mg, 1mg, 5mg, 10mg, 25mg.
(3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one (CAS 468-53-1) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 289.4 g/mol. IUPAC name: (3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one. InChIKey: DAHIQPJTGIHDGO-IAGOWNOFSA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | (3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one |
| InChIKey | DAHIQPJTGIHDGO-IAGOWNOFSA-N |
| SMILES | CN1CC[C@@]2([C@H]1CC(=O)CC2)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)