Products 4684-28-0
CAS 4684-28-0 appears in our catalog under these names: Scopolamine EP Impurity A (Norscopolamine, Norhyoscine), Hyoscine EP Impurity A,Hyoscine hydrobromide EP Impurity B, Nor Scopolamine, >95% (HPLC), Norscopolamine, Norscopolamine, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: on request, 50mg, 5mg, 10mg, 20MG, 1x10mg, 1x5ml.
[(1R,2R,4S,5S)-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate (CAS 4684-28-0) is a chemical compound with the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. IUPAC name: [(1R,2R,4S,5S)-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate. InChIKey: MOYZEMOPQDTDHA-YQYZCKNZSA-N.
| Molecular formula | C16H19NO4 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | [(1R,2R,4S,5S)-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate |
| InChIKey | MOYZEMOPQDTDHA-YQYZCKNZSA-N |
| SMILES | C1[C@@H]2[C@@H]3[C@@H](O3)[C@@H](N2)CC1OC(=O)[C@H](CO)C4=CC=CC=C4 |
Computed by PubChem (NCBI)