CAS 468741-02-8 is the registry number for 4-Amino-5-methyl-3-nitrobenzonitrile. Offered by: TRC. Available pack sizes: 5g.
4-amino-3-methyl-5-nitrobenzonitrile (CAS 468741-02-8) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 4-amino-3-methyl-5-nitrobenzonitrile. InChIKey: VMNUNODKDDCZKW-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 4-amino-3-methyl-5-nitrobenzonitrile |
| InChIKey | VMNUNODKDDCZKW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)