CAS 468741-20-0 is the registry number for 2-Methyl-4-morpholino-6-nitroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methyl-4-morpholin-4-yl-6-nitroaniline (CAS 468741-20-0) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: 2-methyl-4-morpholin-4-yl-6-nitroaniline. InChIKey: BQZOMWPTJWWTMQ-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-methyl-4-morpholin-4-yl-6-nitroaniline |
| InChIKey | BQZOMWPTJWWTMQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)[N+](=O)[O-])N2CCOCC2 |
Computed by PubChem (NCBI)