CAS 469-73-8 is the registry number for 2-Hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid (CAS 469-73-8) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid. InChIKey: DSOMZNUWRKIACY-UHFFFAOYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
| InChIKey | DSOMZNUWRKIACY-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC(C2)(C1O)C(=O)O)C |
Computed by PubChem (NCBI)