CAS 470-24-6 is the registry number for (2R,3R,4S,5R)-2,5-Bis(hydroxymethyl)tetrahydrofuran-2,3,4-triol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol (CAS 470-24-6) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. IUPAC name: (2R,3R,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol. InChIKey: RFSUNEUAIZKAJO-KVTDHHQDSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol |
| InChIKey | RFSUNEUAIZKAJO-KVTDHHQDSA-N |
| SMILES | C([C@@H]1[C@H]([C@H]([C@](O1)(CO)O)O)O)O |
Computed by PubChem (NCBI)