CAS 4717-38-8 appears in our catalog under these names: Ethinylestradiol EP Impurity A (17-epi Ethynyl Estradiol), Ethinylestradiol Impurity 1(Ethinylestradiol EP Impurity A), 17-epi-Ethynyl Estradiol, >95% (HPLC), 17-epi-Ethynyl estradiol, Ethinylestradiol impurity 3. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
(8R,9S,13S,14S,17S)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (CAS 4717-38-8) is a chemical compound with the molecular formula C20H24O2 and a molecular weight of 296.4 g/mol. IUPAC name: (8R,9S,13S,14S,17S)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol. InChIKey: BFPYWIDHMRZLRN-SWBPCFCJSA-N.
| Molecular formula | C20H24O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (8R,9S,13S,14S,17S)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | BFPYWIDHMRZLRN-SWBPCFCJSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@]2(C#C)O)CCC4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)