Products 58573-94-7
CAS 58573-94-7 appears in our catalog under these names: 4-Heptyl-4'-carboxybiphenyl, 95%, 4'–Heptyl–(1,1'–biphenyl)–4–carboxylic acid, 4-(4-Heptylphenyl)benzoic Acid, 4-(4-Heptylphenyl)benzoic Acid, >98.0%(T), 4'-Heptyl-[1,1'-biphenyl]-4-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 1g, 2g, 10g, 50g, 25g.
4-(4-heptylphenyl)benzoic acid (CAS 58573-94-7) is a chemical compound with the molecular formula C20H24O2 and a molecular weight of 296.4 g/mol. IUPAC name: 4-(4-heptylphenyl)benzoic acid. InChIKey: XVROSBHWACAQRL-UHFFFAOYSA-N.
| Molecular formula | C20H24O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 4-(4-heptylphenyl)benzoic acid |
| InChIKey | XVROSBHWACAQRL-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(4-Heptylphenyl)benzoic Acid, 4-Heptyl-4'-carboxybiphenyl, 4-(4-n-heptylphenyl)benzoic acid, 4-(4'-n-heptylphenyl)benzoic acid, 4-Heptylbiphenyl-4'-carboxylic Acid, 4-Heptyl-4'-biphenylcarboxylic acid, 4'-Heptyl-4-biphenylcarboxylic acid, 4-[4-(n-heptyl)phenyl]benzoic acid, 4-n-heptyl-biphenyl-4'-carboxylic acid, 4'-heptyl-1,1'-biphenyl-4-carboxylic acid