CAS 47192-97-2 appears in our catalog under these names: Thebaol Acetate (1.0mg/ml in Acetonitrile), Thebaol Acetate, >95% (HPLC). Offered by: TRC. Available pack sizes: 1x1ml, 2,5mg, 25mg.
(3,6-dimethoxyphenanthren-4-yl) acetate (CAS 47192-97-2) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: (3,6-dimethoxyphenanthren-4-yl) acetate. InChIKey: RIUJHBDYSWDQNC-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | (3,6-dimethoxyphenanthren-4-yl) acetate |
| InChIKey | RIUJHBDYSWDQNC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=CC2=C1C3=C(C=C2)C=CC(=C3)OC)OC |
Computed by PubChem (NCBI)