CAS 47275-11-6 is the registry number for 5–(1,3–Dioxoisoindolin–2–yl)isophthalic acid. Offered by: GLPBio. Available pack sizes: 1g, 5g.
5-(1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxylic acid (CAS 47275-11-6) is a chemical compound with the molecular formula C16H9NO6 and a molecular weight of 311.24 g/mol. IUPAC name: 5-(1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxylic acid. InChIKey: WPNQLRHQPSJNDY-UHFFFAOYSA-N.
| Molecular formula | C16H9NO6 |
|---|---|
| Molecular weight | 311.24 g/mol |
| IUPAC name | 5-(1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | WPNQLRHQPSJNDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)