CAS 7702-03-6 appears in our catalog under these names: 2-(4-Carboxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(4-Carboxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(4-carboxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 7702-03-6) is a chemical compound with the molecular formula C16H9NO6 and a molecular weight of 311.24 g/mol. IUPAC name: 2-(4-carboxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: PRBOQCWKGNKHPS-UHFFFAOYSA-N.
| Molecular formula | C16H9NO6 |
|---|---|
| Molecular weight | 311.24 g/mol |
| IUPAC name | 2-(4-carboxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | PRBOQCWKGNKHPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)