Products 475-80-9

Name: Aristolochic acid B/ 99.99%
Availability: InStock

CAS 475-80-9 appears in our catalog under these names: Aristolochic acid B/ 99.99%, Aristolochic acid B 97%, 6-Nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylic acid, 97%, 97%, Aristolochic acid B (Standard), Aristolochic acid B, 99.92%. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress, Roth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, Get quote.

Aristolochic acid B is an aristolochic acid that is phenanthrene-1-carboxylic acid substituted by a methylenedioxy group at the 3,4 positions and by a nitro group at position 10. It has a role as a metabolite, a mutagen, a carcinogenic agent and a nephrotoxin. It is a member of aristolochic acids, a monocarboxylic acid, an aromatic ether, a C-nitro compound, an organic heterotetracyclic compound and a cyclic acetal.

Source: ChEBI

Identity
Molecular formula	C₁₆H₉NO₆
Molecular weight	311.24 g/mol
IUPAC name	6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid
InChIKey	MEEXETVZNQYRSP-UHFFFAOYSA-N
SMILES	C1OC2=C(O1)C3=C(C(=C2)C(=O)O)C(=CC4=CC=CC=C43)[N+](=O)[O-]

Computed by PubChem (NCBI)

Synonyms: Aristolochic acid B, Aristolochic acid II, 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid, Phenanthro(3,4-d)-1,3-dioxole-5-carboxylic acid, 6-nitro-, 6-nitronaphtho(2,1-g)(1,3)benzodioxole-5-carboxylic acid, 6-nitrophenanthro(3,4-d)-3-dioxole-5-carboxylic acid, 6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid, AristolochicacidB, 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylic acid, 6-nitro-2H-phenanthro[3,4-d][1,3]dioxole-5-carboxylic acid

Products 475-80-9

Aristolochic acid B/ 99.99%

Aristolochic acid B 97%

6-Nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylic acid, 97%, 97%

Aristolochic acid B (Standard)

Aristolochic acid B, 99.92%

Aristolochic acid II, ROTICHROM® HPLC, 20 mg, glass

Isomers (same molecular formula)