CAS 475-80-9 appears in our catalog under these names: Aristolochic acid B/ 99.99%, Aristolochic acid B (Standard), Aristolochic acid B, 99.92%, Aristolochic acid II, ROTICHROM® HPLC, 20 mg, glass, Aristolochic acid B, 97%. Offered by: TargetMol, MedChemExpress, Roth, Ambeed, BLDpharm. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, Get quote, 1 mg.
Aristolochic acid B is an aristolochic acid that is phenanthrene-1-carboxylic acid substituted by a methylenedioxy group at the 3,4 positions and by a nitro group at position 10. It has a role as a metabolite, a mutagen, a carcinogenic agent and a nephrotoxin. It is a member of aristolochic acids, a monocarboxylic acid, an aromatic ether, a C-nitro compound, an organic heterotetracyclic compound and a cyclic acetal.
Source: ChEBI
| Molecular formula | C16H9NO6 |
|---|---|
| Molecular weight | 311.24 g/mol |
| IUPAC name | 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
| InChIKey | MEEXETVZNQYRSP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C3=C(C(=C2)C(=O)O)C(=CC4=CC=CC=C43)[N+](=O)[O-] |
Computed by PubChem (NCBI)