CAS 4732-70-1 is the registry number for 3,4-Dimethoxybenzoylformic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3,4-dimethoxyphenyl)-2-oxoacetic acid (CAS 4732-70-1) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-2-oxoacetic acid. InChIKey: BMGOAOMKRNIFAM-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-2-oxoacetic acid |
| InChIKey | BMGOAOMKRNIFAM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C(=O)O)OC |
Computed by PubChem (NCBI)