CAS 473596-87-1 appears in our catalog under these names: 2–Methyl–4–methoxycarbonylphenylboronic acid pinacol ester, 4-(Methoxycarbonyl)-2-methylphenylboronic Acid Pinacol Ester, 98%, 98%, 4-(Methoxycarbonyl)-2-methylphenylboronic acid pinacol ester, 95%, Methyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 10g, 250mg, 1g, 100g.
Methyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 473596-87-1) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: methyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: RDBWYSWPXDSHOE-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | methyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | RDBWYSWPXDSHOE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OC)C |
Computed by PubChem (NCBI)