CAS 473734-93-9 is the registry number for 3-Amino-2-hydroxybenzenesulfonamide. Offered by: TRC. Available pack sizes: 1g.
3-amino-2-hydroxybenzenesulfonamide (CAS 473734-93-9) is a chemical compound with the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. IUPAC name: 3-amino-2-hydroxybenzenesulfonamide. InChIKey: NCEQZOSYJADYDH-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O3S |
|---|---|
| Molecular weight | 188.21 g/mol |
| IUPAC name | 3-amino-2-hydroxybenzenesulfonamide |
| InChIKey | NCEQZOSYJADYDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)N)O)N |
Computed by PubChem (NCBI)