Products 476199-19-6
CAS 476199-19-6 is the registry number for S-(2-Formyl-5-methoxyphenyl) N,N-dimethylcarbamothioate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
S-(2-formyl-5-methoxyphenyl) N,N-dimethylcarbamothioate (CAS 476199-19-6) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: S-(2-formyl-5-methoxyphenyl) N,N-dimethylcarbamothioate. InChIKey: FWLPREVIVMFINC-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | S-(2-formyl-5-methoxyphenyl) N,N-dimethylcarbamothioate |
| InChIKey | FWLPREVIVMFINC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)SC1=C(C=CC(=C1)OC)C=O |
Computed by PubChem (NCBI)