Products 477-20-3
CAS 477-20-3 is the registry number for Homolycorine. Offered by: Chemat Brand. Available pack sizes: on request.
(5aR,11bS,11cS)-9,10-dimethoxy-1-methyl-2,3,5,5a,11b,11c-hexahydroisochromeno[3,4-g]indol-7-one (CAS 477-20-3) is a chemical compound with the molecular formula C18H21NO4 and a molecular weight of 315.4 g/mol. IUPAC name: (5aR,11bS,11cS)-9,10-dimethoxy-1-methyl-2,3,5,5a,11b,11c-hexahydroisochromeno[3,4-g]indol-7-one. InChIKey: WXZAKVLYZHWSNF-KBRIMQKVSA-N.
| Molecular formula | C18H21NO4 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | (5aR,11bS,11cS)-9,10-dimethoxy-1-methyl-2,3,5,5a,11b,11c-hexahydroisochromeno[3,4-g]indol-7-one |
| InChIKey | WXZAKVLYZHWSNF-KBRIMQKVSA-N |
| SMILES | CN1CCC2=CC[C@@H]3[C@H]([C@@H]21)C4=CC(=C(C=C4C(=O)O3)OC)OC |
Computed by PubChem (NCBI)