CAS 477191-79-0 is the registry number for 4-Iodo-N,N-bis(1-methylethyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
4-iodo-N,N-di(propan-2-yl)benzamide (CAS 477191-79-0) is a chemical compound with the molecular formula C13H18INO and a molecular weight of 331.19 g/mol. IUPAC name: 4-iodo-N,N-di(propan-2-yl)benzamide. InChIKey: YTDOXNTWNWFWPG-UHFFFAOYSA-N.
| Molecular formula | C13H18INO |
|---|---|
| Molecular weight | 331.19 g/mol |
| IUPAC name | 4-iodo-N,N-di(propan-2-yl)benzamide |
| InChIKey | YTDOXNTWNWFWPG-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)I |
Computed by PubChem (NCBI)