CAS 77542-27-9 appears in our catalog under these names: 1-BENZYL-1-METHYL-4-OXOPIPERIDINIUM IODIDE, 95%, 95%, 1-BENZYL-1-METHYL-4-OXOPIPERIDINIUM IODIDE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
1-benzyl-1-methylpiperidin-1-ium-4-one iodide (CAS 77542-27-9) is a chemical compound with the molecular formula C13H18INO and a molecular weight of 331.19 g/mol. IUPAC name: 1-benzyl-1-methylpiperidin-1-ium-4-one iodide. InChIKey: GXCBGFSXHBBEFW-UHFFFAOYSA-M.
| Molecular formula | C13H18INO |
|---|---|
| Molecular weight | 331.19 g/mol |
| IUPAC name | 1-benzyl-1-methylpiperidin-1-ium-4-one iodide |
| InChIKey | GXCBGFSXHBBEFW-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCC(=O)CC1)CC2=CC=CC=C2.[I-] |
Computed by PubChem (NCBI)