CAS 57019-81-5 appears in our catalog under these names: 5-Methoxy-1,2,3,3-tetramethyl-3H-indol-1-ium iodide, 97%, 97%, 5-Methoxy-1,2,3,3-tetramethyl-3H-indol-1-ium iodide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-methoxy-1,2,3,3-tetramethylindol-1-ium iodide (CAS 57019-81-5) is a chemical compound with the molecular formula C13H18INO and a molecular weight of 331.19 g/mol. IUPAC name: 5-methoxy-1,2,3,3-tetramethylindol-1-ium iodide. InChIKey: RWQPMAMEPSNFTP-UHFFFAOYSA-M.
| Molecular formula | C13H18INO |
|---|---|
| Molecular weight | 331.19 g/mol |
| IUPAC name | 5-methoxy-1,2,3,3-tetramethylindol-1-ium iodide |
| InChIKey | RWQPMAMEPSNFTP-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C2=C(C1(C)C)C=C(C=C2)OC)C.[I-] |
Computed by PubChem (NCBI)