CAS 477250-51-4 is the registry number for (R)–3–Amino–4–(1H–indol–3–yl)butanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
(3R)-3-amino-4-(1H-indol-3-yl)butanoic acid;hydrochloride (CAS 477250-51-4) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: (3R)-3-amino-4-(1H-indol-3-yl)butanoic acid;hydrochloride. InChIKey: XALSUNLRNHITKL-SBSPUUFOSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | (3R)-3-amino-4-(1H-indol-3-yl)butanoic acid;hydrochloride |
| InChIKey | XALSUNLRNHITKL-SBSPUUFOSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)