CAS 477865-31-9 is the registry number for Methyl (4z)-4-[(dimethylamino)methylidene]-2-methyl-5-oxo-4,5-dihydro-1h-pyrrole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl (4Z)-4-(dimethylaminomethylidene)-2-methyl-5-oxo-1H-pyrrole-3-carboxylate (CAS 477865-31-9) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: methyl (4Z)-4-(dimethylaminomethylidene)-2-methyl-5-oxo-1H-pyrrole-3-carboxylate. InChIKey: KICJMJFFJNGVOV-ALCCZGGFSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl (4Z)-4-(dimethylaminomethylidene)-2-methyl-5-oxo-1H-pyrrole-3-carboxylate |
| InChIKey | KICJMJFFJNGVOV-ALCCZGGFSA-N |
| SMILES | CC1=C(/C(=C/N(C)C)/C(=O)N1)C(=O)OC |
Computed by PubChem (NCBI)