Products 477953-07-4
CAS 477953-07-4 is the registry number for Neostenine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
(1S,9R,10R,11R,14S,15R,16R)-10-ethyl-14-methyl-12-oxa-4-azatetracyclo[7.6.1.04,16.011,15]hexadecan-13-one (CAS 477953-07-4) is a chemical compound with the molecular formula C17H27NO2 and a molecular weight of 277.4 g/mol. IUPAC name: (1S,9R,10R,11R,14S,15R,16R)-10-ethyl-14-methyl-12-oxa-4-azatetracyclo[7.6.1.04,16.011,15]hexadecan-13-one. InChIKey: ROIHYOJMCBKEER-FGBMJVKNSA-N.
| Molecular formula | C17H27NO2 |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | (1S,9R,10R,11R,14S,15R,16R)-10-ethyl-14-methyl-12-oxa-4-azatetracyclo[7.6.1.04,16.011,15]hexadecan-13-one |
| InChIKey | ROIHYOJMCBKEER-FGBMJVKNSA-N |
| SMILES | CC[C@@H]1[C@H]2CCCCN3[C@H]2[C@@H](CC3)[C@H]4[C@@H]1OC(=O)[C@H]4C |
Computed by PubChem (NCBI)