CAS 478249-18-2 is the registry number for (4-Benzylpiperazino)(5-chloro-2-nitrophenyl)methanone. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
(4-benzylpiperazin-1-yl)-(5-chloro-2-nitrophenyl)methanone (CAS 478249-18-2) is a chemical compound with the molecular formula C18H18ClN3O3 and a molecular weight of 359.8 g/mol. IUPAC name: (4-benzylpiperazin-1-yl)-(5-chloro-2-nitrophenyl)methanone. InChIKey: AVGXKCSLLHIDIB-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3O3 |
|---|---|
| Molecular weight | 359.8 g/mol |
| IUPAC name | (4-benzylpiperazin-1-yl)-(5-chloro-2-nitrophenyl)methanone |
| InChIKey | AVGXKCSLLHIDIB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)C(=O)C3=C(C=CC(=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)