Products 478506-36-4
CAS 478506-36-4 is the registry number for L-(-)-Sorbose-13C-1. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(3S,4R,5S)-2-(hydroxymethyl)(513C)oxane-2,3,4,5-tetrol (CAS 478506-36-4) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (3S,4R,5S)-2-(hydroxymethyl)(513C)oxane-2,3,4,5-tetrol. InChIKey: LKDRXBCSQODPBY-VJMGYBMTSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (3S,4R,5S)-2-(hydroxymethyl)(513C)oxane-2,3,4,5-tetrol |
| InChIKey | LKDRXBCSQODPBY-VJMGYBMTSA-N |
| SMILES | C1[13C@@H]([C@H]([C@@H](C(O1)(CO)O)O)O)O |
Computed by PubChem (NCBI)