Products 478506-42-2
CAS 478506-42-2 is the registry number for D-Tagatose-13C. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 10 mg, 5 mg.
(3S,4S,5R)-2-(hydroxy(113C)methyl)oxane-2,3,4,5-tetrol (CAS 478506-42-2) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (3S,4S,5R)-2-(hydroxy(113C)methyl)oxane-2,3,4,5-tetrol. InChIKey: LKDRXBCSQODPBY-HMWKXFOSSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (3S,4S,5R)-2-(hydroxy(113C)methyl)oxane-2,3,4,5-tetrol |
| InChIKey | LKDRXBCSQODPBY-HMWKXFOSSA-N |
| SMILES | C1[C@H]([C@@H]([C@@H](C(O1)([13CH2]O)O)O)O)O |
Computed by PubChem (NCBI)