CAS 478518-48-8 is the registry number for D-Fructose-d2-1. Offered by: MedChemExpress. Available pack sizes: 250 mg.
(3S,4R,5R)-4,5-dideuterio-2-(hydroxymethyl)oxane-2,3,4,5-tetrol (CAS 478518-48-8) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 182.17 g/mol. IUPAC name: (3S,4R,5R)-4,5-dideuterio-2-(hydroxymethyl)oxane-2,3,4,5-tetrol. InChIKey: LKDRXBCSQODPBY-ZXFUQIHSSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (3S,4R,5R)-4,5-dideuterio-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| InChIKey | LKDRXBCSQODPBY-ZXFUQIHSSA-N |
| SMILES | [2H][C@]1(COC([C@H]([C@]1([2H])O)O)(CO)O)O |
Computed by PubChem (NCBI)