Products 478518-56-8
CAS 478518-56-8 is the registry number for D-Galactose-13C-2, 99.9%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 50 mg, 10 mg, 5 mg.
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxy(313C)hexanal (CAS 478518-56-8) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxy(313C)hexanal. InChIKey: GZCGUPFRVQAUEE-XWVGIIHOSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxy(313C)hexanal |
| InChIKey | GZCGUPFRVQAUEE-XWVGIIHOSA-N |
| SMILES | C([C@H]([C@@H]([13C@@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)