CAS 478518-70-6 is the registry number for D-Galactose-d1-2. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 250 mg, 100 mg.
(3R,4S,5R,6R)-4-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (CAS 478518-70-6) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.16 g/mol. IUPAC name: (3R,4S,5R,6R)-4-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-FYEWKVIJSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | (3R,4S,5R,6R)-4-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-FYEWKVIJSA-N |
| SMILES | [2H][C@@]1([C@H]([C@H](OC([C@@H]1O)O)CO)O)O |
Computed by PubChem (NCBI)