Products 478519-02-7
CAS 478519-02-7 appears in our catalog under these names: L-Glucose-1-13C, >95% (HPLC), L-Glucose-13C, 95%, L–(1–13C)glucose, L-Glucose-13C, 98%, 98%, L-Glucose-13C, 98.0%. Offered by: TRC, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 25mg, 10mg, 500mg, 25 mg, 50 mg, 250 mg, 100 mg.
(3S,4R,5R,6S)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol (CAS 478519-02-7) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (3S,4R,5R,6S)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-WIZIAPGRSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (3S,4R,5R,6S)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-WIZIAPGRSA-N |
| SMILES | C([C@H]1[C@@H]([C@H]([C@@H]([13CH](O1)O)O)O)O)O |
Computed by PubChem (NCBI)