CAS 478529-32-7 appears in our catalog under these names: D-Glucose-13C3-1, 98%, D-Glucose-1,2,3-13C3, D-Glucose-13C3-1. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 25 mg, 10 mg, 1 mg, 50 mg, 100 mg.
(3R,4S,5S,6R)-6-(hydroxymethyl)(2,3,4-13C3)oxane-2,3,4,5-tetrol (CAS 478529-32-7) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 183.13 g/mol. IUPAC name: (3R,4S,5S,6R)-6-(hydroxymethyl)(2,3,4-13C3)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-VJPMIEPHSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 183.13 g/mol |
| IUPAC name | (3R,4S,5S,6R)-6-(hydroxymethyl)(2,3,4-13C3)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-VJPMIEPHSA-N |
| SMILES | C([C@@H]1[C@H]([13C@@H]([13C@H]([13CH](O1)O)O)O)O)O |
Computed by PubChem (NCBI)