Products 478529-47-4
CAS 478529-47-4 is the registry number for D-Glucose-13C3-2, 98%. Offered by: MedChemExpress. Available pack sizes: 5 mg.
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(4,5,6-13C3)hexanal (CAS 478529-47-4) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 183.13 g/mol. IUPAC name: (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(4,5,6-13C3)hexanal. InChIKey: GZCGUPFRVQAUEE-VPGZLUDVSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 183.13 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy(4,5,6-13C3)hexanal |
| InChIKey | GZCGUPFRVQAUEE-VPGZLUDVSA-N |
| SMILES | [13CH2]([13C@H]([13C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)