Products 478529-48-5
CAS 478529-48-5 is the registry number for D-Glucose-d2-1. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(3R,4S,5S,6R)-5,6-dideuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (CAS 478529-48-5) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 182.17 g/mol. IUPAC name: (3R,4S,5S,6R)-5,6-dideuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-XMOTWBSASA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (3R,4S,5S,6R)-5,6-dideuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-XMOTWBSASA-N |
| SMILES | [2H][C@]1([C@@]([C@@H]([C@H](C(O1)O)O)O)([2H])O)CO |
Computed by PubChem (NCBI)