CAS 478529-49-6 appears in our catalog under these names: D-Glucose-4,5,6,6’-d4, >95% (HPLC), D-Glucose-d4, 99.0%. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5 mg, 25 mg, 50 mg, 10 mg.
(3R,4S,5S,6R)-5,6-dideuterio-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol (CAS 478529-49-6) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 184.18 g/mol. IUPAC name: (3R,4S,5S,6R)-5,6-dideuterio-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-SSBPLVJNSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | (3R,4S,5S,6R)-5,6-dideuterio-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-SSBPLVJNSA-N |
| SMILES | [2H][C@@]1([C@@H]([C@H](C(O[C@]1([2H])C([2H])([2H])O)O)O)O)O |
Computed by PubChem (NCBI)