Products 478868-67-6
CAS 478868-67-6 is the registry number for Ethyl 4-(2,6-dichlorophenyl)-2,4-dioxobutanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-(2,6-dichlorophenyl)-2,4-dioxobutanoate (CAS 478868-67-6) is a chemical compound with the molecular formula C12H10Cl2O4 and a molecular weight of 289.11 g/mol. IUPAC name: ethyl 4-(2,6-dichlorophenyl)-2,4-dioxobutanoate. InChIKey: OXPBTXVQBDIPLW-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2O4 |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | ethyl 4-(2,6-dichlorophenyl)-2,4-dioxobutanoate |
| InChIKey | OXPBTXVQBDIPLW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)