CAS 936099-40-0 is the registry number for 3,4-Dichloro-5-(2,4-dimethoxyphenyl)furan-2(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-2-(2,4-dimethoxyphenyl)-2H-furan-5-one (CAS 936099-40-0) is a chemical compound with the molecular formula C12H10Cl2O4 and a molecular weight of 289.11 g/mol. IUPAC name: 3,4-dichloro-2-(2,4-dimethoxyphenyl)-2H-furan-5-one. InChIKey: QJOJCORROLYKPH-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2O4 |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | 3,4-dichloro-2-(2,4-dimethoxyphenyl)-2H-furan-5-one |
| InChIKey | QJOJCORROLYKPH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2C(=C(C(=O)O2)Cl)Cl)OC |
Computed by PubChem (NCBI)