Products 478868-68-7
CAS 478868-68-7 is the registry number for Ethyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 25g, 1g, 5g.
Ethyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate (CAS 478868-68-7) is a chemical compound with the molecular formula C12H10Cl2O4 and a molecular weight of 289.11 g/mol. IUPAC name: ethyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate. InChIKey: YVLZWVABZPQWJC-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2O4 |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | ethyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate |
| InChIKey | YVLZWVABZPQWJC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
ethyl 4-(2,4-dichlorophenyl)-2,4-dioxobutanoate, benzenebutanoic acid, 2,4-dichloro-alpha,gamma-dioxo-, ethyl ester, Ethyl 4-(2,4-dichlorophenyl)-2,4-dioxobutyrate, YVLZWVABZPQWJC-UHFFFAOYSA-N, ethyl 4-(2,4-dichlorophenyl)-2,4-diketobutyrate, ethyl 4-(2,4-dichlorophenyl)-2,4-dioxo-butanoate, 4-(2,4-dichlorophenyl)-2,4-dioxobutanoic acid ethyl ester