CAS 479064-87-4 appears in our catalog under these names: H-D-β-Phe(4-Me)-OH, 97%, (R)-3-(P-Methylphenyl)-beta-alanine, 95%, (R)-3-(p-Methylphenyl)-beta-alanine, 97%, 97%, (R)-ß-(p-Methylphenyl)alanine, 97%. Offered by: Ambeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(3R)-3-amino-3-(4-methylphenyl)propanoic acid (CAS 479064-87-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3R)-3-amino-3-(4-methylphenyl)propanoic acid. InChIKey: XPDAKEOBPKFUAH-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-methylphenyl)propanoic acid |
| InChIKey | XPDAKEOBPKFUAH-SECBINFHSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)