Products 479677-45-7
CAS 479677-45-7 is the registry number for (2S)-2-Amino-3-hydroxy-6-(trimethylammonio)hexanoate. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-3-hydroxy-6-(trimethylazaniumyl)hexanoate (CAS 479677-45-7) is a chemical compound with the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. IUPAC name: (2S)-2-amino-3-hydroxy-6-(trimethylazaniumyl)hexanoate. InChIKey: ZRJHLGYVUCPZNH-MQWKRIRWSA-N.
| Molecular formula | C9H20N2O3 |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | (2S)-2-amino-3-hydroxy-6-(trimethylazaniumyl)hexanoate |
| InChIKey | ZRJHLGYVUCPZNH-MQWKRIRWSA-N |
| SMILES | C[N+](C)(C)CCCC([C@@H](C(=O)[O-])N)O |
Computed by PubChem (NCBI)