CAS 480-83-1 appears in our catalog under these names: Echinatine, (+)-Echinatine. Offered by: GLPBio, Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: 1mg, on request, 10mg, 2mg, 5mg, Get quote.
[(7S,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2S)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate (CAS 480-83-1) is a chemical compound with the molecular formula C15H25NO5 and a molecular weight of 299.36 g/mol. IUPAC name: [(7S,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2S)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate. InChIKey: SFVVQRJOGUKCEG-DNVSUFBTSA-N.
| Molecular formula | C15H25NO5 |
|---|---|
| Molecular weight | 299.36 g/mol |
| IUPAC name | [(7S,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2S)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate |
| InChIKey | SFVVQRJOGUKCEG-DNVSUFBTSA-N |
| SMILES | C[C@@H]([C@@](C(C)C)(C(=O)OCC1=CCN2[C@H]1[C@H](CC2)O)O)O |
Computed by PubChem (NCBI)