Products 2242945-39-5

CAS 2242945-39-5 is the registry number for 1-(tert-Butyl) 4-ethyl 2-methyl-5-oxoazepane-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-O-tert-butyl 4-O-ethyl 2-methyl-5-oxoazepane-1,4-dicarboxylate (CAS 2242945-39-5) is a chemical compound with the molecular formula C15H25NO5 and a molecular weight of 299.36 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 2-methyl-5-oxoazepane-1,4-dicarboxylate. InChIKey: SIOYFURJDBUWTG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H25NO5
Molecular weight299.36 g/mol
IUPAC name1-O-tert-butyl 4-O-ethyl 2-methyl-5-oxoazepane-1,4-dicarboxylate
InChIKeySIOYFURJDBUWTG-UHFFFAOYSA-N
SMILESCCOC(=O)C1CC(N(CCC1=O)C(=O)OC(C)(C)C)C

Computed by PubChem (NCBI)