CAS 1001353-88-3 appears in our catalog under these names: 1-tert-Butyl 2-ethyl 2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate, 95%, 1-tert-Butyl 2-ethyl 2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-O-tert-butyl 2-O-ethyl 2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate (CAS 1001353-88-3) is a chemical compound with the molecular formula C15H25NO5 and a molecular weight of 299.36 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: XFEXPUYIPCIZCE-UHFFFAOYSA-N.
| Molecular formula | C15H25NO5 |
|---|---|
| Molecular weight | 299.36 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl 2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | XFEXPUYIPCIZCE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC(C(=O)N1C(=O)OC(C)(C)C)(C)C)C |
Computed by PubChem (NCBI)