CAS 4803-57-0 appears in our catalog under these names: Donepezil EP Impurity D (Donepezil Pyridine Analog Impurity), Donepezil Impurity N, Donepezil Pyridine Analog Impurity, Donepezil Impurity 7, 5,6-Dimethoxy-2-(4-pyridylmethyl)-1-indanone, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
5,6-dimethoxy-2-(pyridin-4-ylmethyl)-2,3-dihydroinden-1-one (CAS 4803-57-0) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: 5,6-dimethoxy-2-(pyridin-4-ylmethyl)-2,3-dihydroinden-1-one. InChIKey: RGPDMDJBVKHZFW-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 5,6-dimethoxy-2-(pyridin-4-ylmethyl)-2,3-dihydroinden-1-one |
| InChIKey | RGPDMDJBVKHZFW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC(C2=O)CC3=CC=NC=C3)OC |
Computed by PubChem (NCBI)