CAS 480424-52-0 appears in our catalog under these names: 3-Formyl-2-isopropoxy-5-methylphenylboronic acid, 95%, (3-Formyl-2-isopropoxy-5-methylphenyl)boronic acid 95%, 3-Formyl-2-isopropoxy-5-methylphenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
(3-formyl-5-methyl-2-propan-2-yloxyphenyl)boronic acid (CAS 480424-52-0) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: (3-formyl-5-methyl-2-propan-2-yloxyphenyl)boronic acid. InChIKey: GJCSGBGUVKZHMG-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | (3-formyl-5-methyl-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | GJCSGBGUVKZHMG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC(C)C)C=O)C)(O)O |
Computed by PubChem (NCBI)