Products 480439-19-8
CAS 480439-19-8 is the registry number for 3-Bromo-2,4,6-trimethylphenyl isocyanate, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg.
2-bromo-4-isocyanato-1,3,5-trimethylbenzene (CAS 480439-19-8) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 2-bromo-4-isocyanato-1,3,5-trimethylbenzene. InChIKey: PXIWEPBSGPAODI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 2-bromo-4-isocyanato-1,3,5-trimethylbenzene |
| InChIKey | PXIWEPBSGPAODI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1N=C=O)C)Br)C |
Computed by PubChem (NCBI)