Products 480452-24-2
CAS 480452-24-2 is the registry number for Antibiofilm agent-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
Phenyl N-(4-chloroanilino)carbamate (CAS 480452-24-2) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: phenyl N-(4-chloroanilino)carbamate. InChIKey: KKENYRKTZAIZKB-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | phenyl N-(4-chloroanilino)carbamate |
| InChIKey | KKENYRKTZAIZKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NNC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)