Products 4808-64-4
CAS 4808-64-4 appears in our catalog under these names: 2,6-Dimethyl-4-nitropyridine N-oxide, 2,6-Dimethyl-4-nitropyridine N-oxide, 97%, 2,6-Dimethyl-4-nitropyridine 1-oxide, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
2,6-dimethyl-4-nitro-1-oxidopyridin-1-ium (CAS 4808-64-4) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2,6-dimethyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: LFPUGENPUAERSG-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2,6-dimethyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | LFPUGENPUAERSG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=[N+]1[O-])C)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dimethyl-4-nitropyridine N-oxide, 2,6-Dimethyl-4-nitropyridine 1-oxide, Pyridine, 2,6-dimethyl-4-nitro-, 1-oxide, 4-Nitro-2,6-dimethylpyridine 1-oxide, 2,6-Dimethyl-4-nitro-pyridine 1-oxide, 5-20-06-00052 (Beilstein Handbook Reference), 2,6-Dimethyl-4-nitropyridine-N-oxide, 4-Nitro-2,6-lutidine N-oxide, LFPUGENPUAERSG-UHFFFAOYSA-N, 2,6-dimethyl-4-nitropyridin-1-ium-1-olate