CAS 480996-92-7 appears in our catalog under these names: Methyl 3,7-dimethyl-1h-indole-2-carboxylate, 95%, Methyl 3,7-dimethyl-1H-indole-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Methyl 3,7-dimethyl-1H-indole-2-carboxylate (CAS 480996-92-7) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: methyl 3,7-dimethyl-1H-indole-2-carboxylate. InChIKey: RAGWOSNMOATCDR-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | methyl 3,7-dimethyl-1H-indole-2-carboxylate |
| InChIKey | RAGWOSNMOATCDR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(N2)C(=O)OC)C |
Computed by PubChem (NCBI)